C27H40N2O6 — CID 6607171
[(1S,2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] hept-6-enoate (PubChem CID 6607171) has the molecular formula C27H40N2O6 and a molecular weight of 488.63 g/mol. Its IUPAC name is [(1S,2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] hept-6-enoate.
| Compound Name | [(1S,2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] hept-6-enoate |
|---|---|
| PubChem CID | 6607171 |
| Molecular Formula | C27H40N2O6 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | [(1S,2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)O[C@@H](c1ccccc1)[C@H](COC)NC(=O)[C@H](CC=C)CC(=O)N[C@H](C)CO |
| InChI | InChI=1S/C27H40N2O6/c1-5-7-8-12-16-25(32)35-26(21-14-10-9-11-15-21)23(19-34-4)29-27(33)22(13-6-2)17-24(31)28-20(3)18-30/h5-6,9-11,14-15,20,22-23,26,30H,1-2,7-8,12-13,16-19H2,3-4H3,(H,28,31)(H,29,33)/t20-,22-,23+,26+/m1/s1 |
| InChIKey | ZUZULAVAYVMFEN-XQJVOIGCSA-N |
| XLogP | 3.23 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|