C34H44N2O6 — CID 6607248
[(1S,2S)-2-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] hept-6-enoate (PubChem CID 6607248) has the molecular formula C34H44N2O6 and a molecular weight of 576.73 g/mol. Its IUPAC name is [(1S,2S)-2-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] hept-6-enoate.
| Compound Name | [(1S,2S)-2-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] hept-6-enoate |
|---|---|
| PubChem CID | 6607248 |
| Molecular Formula | C34H44N2O6 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | [(1S,2S)-2-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methoxy-1-phenylpropyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)O[C@@H](c1ccccc1)[C@H](COC)NC(=O)C(CC=C)CC(=O)N1Cc2ccccc2C[C@H]1CO |
| InChI | InChI=1S/C34H44N2O6/c1-4-6-7-11-19-32(39)42-33(25-15-9-8-10-16-25)30(24-41-3)35-34(40)27(14-5-2)21-31(38)36-22-28-18-13-12-17-26(28)20-29(36)23-37/h4-5,8-10,12-13,15-18,27,29-30,33,37H,1-2,6-7,11,14,19-24H2,3H3,(H,35,40)/t27?,29-,30-,33-/m0/s1 |
| InChIKey | DUJWYHIJMOUKPE-UAHUBJDISA-N |
| XLogP | 4.68 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|