C31H38N2O5 — CID 4569695
[2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] hex-5-enoate (PubChem CID 4569695) has the molecular formula C31H38N2O5 and a molecular weight of 518.65 g/mol. Its IUPAC name is [2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] hex-5-enoate.
| Compound Name | [2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] hex-5-enoate |
|---|---|
| PubChem CID | 4569695 |
| Molecular Formula | C31H38N2O5 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | [2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] hex-5-enoate |
| SMILES | C=CCCCC(=O)OCC(NC(=O)C(CC=C)CC(=O)N1Cc2ccccc2CC1CO)c1ccccc1 |
| InChI | InChI=1S/C31H38N2O5/c1-3-5-7-17-30(36)38-22-28(23-13-8-6-9-14-23)32-31(37)25(12-4-2)19-29(35)33-20-26-16-11-10-15-24(26)18-27(33)21-34/h3-4,6,8-11,13-16,25,27-28,34H,1-2,5,7,12,17-22H2,(H,32,37) |
| InChIKey | GITUNEKMPQWVPW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|