C24H32N2O5 — CID 4231359
2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]ethyl pent-4-enoate (PubChem CID 4231359) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]ethyl pent-4-enoate.
| Compound Name | 2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]ethyl pent-4-enoate |
|---|---|
| PubChem CID | 4231359 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]ethyl pent-4-enoate |
| SMILES | C=CCCC(=O)OCCNC(=O)C(CC=C)CC(=O)N1Cc2ccccc2CC1CO |
| InChI | InChI=1S/C24H32N2O5/c1-3-5-11-23(29)31-13-12-25-24(30)19(8-4-2)15-22(28)26-16-20-10-7-6-9-18(20)14-21(26)17-27/h3-4,6-7,9-10,19,21,27H,1-2,5,8,11-17H2,(H,25,30) |
| InChIKey | PIRAVAXNXZIWAN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|