C29H40N2O5 — CID 3399698
[1-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl hept-6-enoate (PubChem CID 3399698) has the molecular formula C29H40N2O5 and a molecular weight of 496.65 g/mol. Its IUPAC name is [1-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl hept-6-enoate.
| Compound Name | [1-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl hept-6-enoate |
|---|---|
| PubChem CID | 3399698 |
| Molecular Formula | C29H40N2O5 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | [1-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl hept-6-enoate |
| SMILES | C=CCCCCC(=O)OCC1CCCN1C(=O)C(CC=C)CC(=O)N1Cc2ccccc2CC1CO |
| InChI | InChI=1S/C29H40N2O5/c1-3-5-6-7-15-28(34)36-21-25-14-10-16-30(25)29(35)23(11-4-2)18-27(33)31-19-24-13-9-8-12-22(24)17-26(31)20-32/h3-4,8-9,12-13,23,25-26,32H,1-2,5-7,10-11,14-21H2 |
| InChIKey | NBWYHOSONKEHBV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|