C26H36N2O5 — CID 122406151
[(2S)-1-[(2S)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl pent-4-enoate (PubChem CID 122406151) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is [(2S)-1-[(2S)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl pent-4-enoate.
| Compound Name | [(2S)-1-[(2S)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl pent-4-enoate |
|---|---|
| PubChem CID | 122406151 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | [(2S)-1-[(2S)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@@H]1CCCN1C(=O)[C@@H](CC=C)CC(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C26H36N2O5/c1-3-5-14-25(31)33-20-23-13-9-15-28(23)26(32)22(10-4-2)18-24(30)27(16-17-29)19-21-11-7-6-8-12-21/h3-4,6-8,11-12,22-23,29H,1-2,5,9-10,13-20H2/t22-,23-/m0/s1 |
| InChIKey | LCFXDPJCBQMARM-GOTSBHOMSA-N |
| XLogP | 3.09 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|