C16H25NO3 — CID 118867234
[(2S)-1-[(2R)-2-methylpent-4-enoyl]pyrrolidin-2-yl]methyl pent-4-enoate (PubChem CID 118867234) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is [(2S)-1-[(2R)-2-methylpent-4-enoyl]pyrrolidin-2-yl]methyl pent-4-enoate.
| Compound Name | [(2S)-1-[(2R)-2-methylpent-4-enoyl]pyrrolidin-2-yl]methyl pent-4-enoate |
|---|---|
| PubChem CID | 118867234 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | [(2S)-1-[(2R)-2-methylpent-4-enoyl]pyrrolidin-2-yl]methyl pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@@H]1CCCN1C(=O)[C@H](C)CC=C |
| InChI | InChI=1S/C16H25NO3/c1-4-6-10-15(18)20-12-14-9-7-11-17(14)16(19)13(3)8-5-2/h4-5,13-14H,1-2,6-12H2,3H3/t13-,14+/m1/s1 |
| InChIKey | PWNCUUDCJGKPED-KGLIPLIRSA-N |
| XLogP | 2.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|