C22H35NO5 — CID 118867054
tert-butyl 3-[2-[(1S)-1-pent-4-enoyloxyethyl]pyrrolidine-1-carbonyl]hex-5-enoate (PubChem CID 118867054) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is tert-butyl 3-[2-[(1S)-1-pent-4-enoyloxyethyl]pyrrolidine-1-carbonyl]hex-5-enoate.
| Compound Name | tert-butyl 3-[2-[(1S)-1-pent-4-enoyloxyethyl]pyrrolidine-1-carbonyl]hex-5-enoate |
|---|---|
| PubChem CID | 118867054 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | tert-butyl 3-[2-[(1S)-1-pent-4-enoyloxyethyl]pyrrolidine-1-carbonyl]hex-5-enoate |
| SMILES | C=CCCC(=O)O[C@@H](C)C1CCCN1C(=O)C(CC=C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35NO5/c1-7-9-13-19(24)27-16(3)18-12-10-14-23(18)21(26)17(11-8-2)15-20(25)28-22(4,5)6/h7-8,16-18H,1-2,9-15H2,3-6H3/t16-,17?,18?/m0/s1 |
| InChIKey | JATGXFFDLHIEGB-AOCRQIFASA-N |
| XLogP | 3.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|