C25H38N2O10 — CID 158150914
tert-butyl 3-(2-oxo-1,3-oxazolidine-3-carbonyl)hex-5-enoate;tert-butyl 4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)butanoate (PubChem CID 158150914) has the molecular formula C25H38N2O10 and a molecular weight of 526.58 g/mol. Its IUPAC name is tert-butyl 3-(2-oxo-1,3-oxazolidine-3-carbonyl)hex-5-enoate;tert-butyl 4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)butanoate.
| Compound Name | tert-butyl 3-(2-oxo-1,3-oxazolidine-3-carbonyl)hex-5-enoate;tert-butyl 4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)butanoate |
|---|---|
| PubChem CID | 158150914 |
| Molecular Formula | C25H38N2O10 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | tert-butyl 3-(2-oxo-1,3-oxazolidine-3-carbonyl)hex-5-enoate;tert-butyl 4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)butanoate |
| SMILES | C=CCC(CC(=O)OC(C)(C)C)C(=O)N1CCOC1=O.CC(C)(C)OC(=O)CCC(=O)N1CCOC1=O |
| InChI | InChI=1S/C14H21NO5.C11H17NO5/c1-5-6-10(9-11(16)20-14(2,3)4)12(17)15-7-8-19-13(15)18;1-11(2,3)17-9(14)5-4-8(13)12-6-7-16-10(12)15/h5,10H,1,6-9H2,2-4H3;4-7H2,1-3H3 |
| InChIKey | FVCDRLGJDVAEEG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|