C18H29NO5 — CID 11151950
tert-butyl (2R,3S)-2-(2-methylpropyl)-3-(2-oxo-1,3-oxazolidine-3-carbonyl)hex-5-enoate (PubChem CID 11151950) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-(2-methylpropyl)-3-(2-oxo-1,3-oxazolidine-3-carbonyl)hex-5-enoate.
| Compound Name | tert-butyl (2R,3S)-2-(2-methylpropyl)-3-(2-oxo-1,3-oxazolidine-3-carbonyl)hex-5-enoate |
|---|---|
| PubChem CID | 11151950 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | tert-butyl (2R,3S)-2-(2-methylpropyl)-3-(2-oxo-1,3-oxazolidine-3-carbonyl)hex-5-enoate |
| SMILES | C=CC[C@H](C(=O)N1CCOC1=O)[C@@H](CC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO5/c1-7-8-13(15(20)19-9-10-23-17(19)22)14(11-12(2)3)16(21)24-18(4,5)6/h7,12-14H,1,8-11H2,2-6H3/t13-,14+/m0/s1 |
| InChIKey | GKMBPVZVMHORDS-UONOGXRCSA-N |
| XLogP | 3.16 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|