C20H39NO3Si — CID 14808647
tert-butyl (2S)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]pyrrolidine-1-carboxylate (PubChem CID 14808647) has the molecular formula C20H39NO3Si and a molecular weight of 369.62 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 14808647 |
| Molecular Formula | C20H39NO3Si |
| Molecular Weight | 369.62 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | tert-butyl (2S)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39NO3Si/c1-10-12-16(15-23-25(8,9)20(5,6)7)17-13-11-14-21(17)18(22)24-19(2,3)4/h10,16-17H,1,11-15H2,2-9H3/t16-,17-/m0/s1 |
| InChIKey | VYCUELAYYJUGFJ-IRXDYDNUSA-N |
| XLogP | 5.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|