C19H28N2O2 — CID 53496142
tert-butyl (2S)-2-(1-anilinobut-3-enyl)pyrrolidine-1-carboxylate (PubChem CID 53496142) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1-anilinobut-3-enyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(1-anilinobut-3-enyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 53496142 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | tert-butyl (2S)-2-(1-anilinobut-3-enyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCC(Nc1ccccc1)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28N2O2/c1-5-10-16(20-15-11-7-6-8-12-15)17-13-9-14-21(17)18(22)23-19(2,3)4/h5-8,11-12,16-17,20H,1,9-10,13-14H2,2-4H3/t16?,17-/m0/s1 |
| InChIKey | GXEFBXOVOMTCRV-DJNXLDHESA-N |
| XLogP | 4.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|