C22H27NO4 — CID 67148408
tert-butyl (2S)-2-(diphenoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 67148408) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is tert-butyl (2S)-2-(diphenoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(diphenoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67148408 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | tert-butyl (2S)-2-(diphenoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C22H27NO4/c1-22(2,3)27-21(24)23-16-10-15-19(23)20(25-17-11-6-4-7-12-17)26-18-13-8-5-9-14-18/h4-9,11-14,19-20H,10,15-16H2,1-3H3/t19-/m0/s1 |
| InChIKey | NMZPFFQHPBJTPW-IBGZPJMESA-N |
| XLogP | 4.87 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|