C19H25NO5 — CID 168867691
tert-butyl 2-[(1S)-1-hydroxy-2-phenoxycarbonylprop-2-enyl]pyrrolidine-1-carboxylate (PubChem CID 168867691) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is tert-butyl 2-[(1S)-1-hydroxy-2-phenoxycarbonylprop-2-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(1S)-1-hydroxy-2-phenoxycarbonylprop-2-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168867691 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | tert-butyl 2-[(1S)-1-hydroxy-2-phenoxycarbonylprop-2-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=C(C(=O)Oc1ccccc1)[C@H](O)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H25NO5/c1-13(17(22)24-14-9-6-5-7-10-14)16(21)15-11-8-12-20(15)18(23)25-19(2,3)4/h5-7,9-10,15-16,21H,1,8,11-12H2,2-4H3/t15?,16-/m0/s1 |
| InChIKey | OFAXKNRWBWSECA-LYKKTTPLSA-N |
| XLogP | 2.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|