C16H21F6NO5 — CID 12003463
tert-butyl (2S)-2-[(1S)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1-hydroxyprop-2-enyl]pyrrolidine-1-carboxylate (PubChem CID 12003463) has the molecular formula C16H21F6NO5 and a molecular weight of 421.33 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1S)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1-hydroxyprop-2-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(1S)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1-hydroxyprop-2-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 12003463 |
| Molecular Formula | C16H21F6NO5 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | tert-butyl (2S)-2-[(1S)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1-hydroxyprop-2-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=C(C(=O)OC(C(F)(F)F)C(F)(F)F)[C@H](O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21F6NO5/c1-8(11(25)27-12(15(17,18)19)16(20,21)22)10(24)9-6-5-7-23(9)13(26)28-14(2,3)4/h9-10,12,24H,1,5-7H2,2-4H3/t9-,10-/m0/s1 |
| InChIKey | LUOOVAUDQQDHIY-UWVGGRQHSA-N |
| XLogP | 3.34 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|