C18H27NO3 — CID 21106393
tert-butyl 2-[hydroxy(phenyl)methyl]azepane-1-carboxylate (PubChem CID 21106393) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl 2-[hydroxy(phenyl)methyl]azepane-1-carboxylate.
| Compound Name | tert-butyl 2-[hydroxy(phenyl)methyl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 21106393 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | tert-butyl 2-[hydroxy(phenyl)methyl]azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCCC1C(O)c1ccccc1 |
| InChI | InChI=1S/C18H27NO3/c1-18(2,3)22-17(21)19-13-9-5-8-12-15(19)16(20)14-10-6-4-7-11-14/h4,6-7,10-11,15-16,20H,5,8-9,12-13H2,1-3H3 |
| InChIKey | SPWDPWFRLDBQRJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |