C26H30N2O3 — CID 145214070
tert-butyl 2-[hydroxy-(4-quinolin-3-ylphenyl)methyl]piperidine-1-carboxylate (PubChem CID 145214070) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is tert-butyl 2-[hydroxy-(4-quinolin-3-ylphenyl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[hydroxy-(4-quinolin-3-ylphenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145214070 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | tert-butyl 2-[hydroxy-(4-quinolin-3-ylphenyl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C(O)c1ccc(-c2cnc3ccccc3c2)cc1 |
| InChI | InChI=1S/C26H30N2O3/c1-26(2,3)31-25(30)28-15-7-6-10-23(28)24(29)19-13-11-18(12-14-19)21-16-20-8-4-5-9-22(20)27-17-21/h4-5,8-9,11-14,16-17,23-24,29H,6-7,10,15H2,1-3H3 |
| InChIKey | GSNOKVWDPAHLRC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |