C21H30N2O4 — CID 144620597
tert-butyl (2R)-2-[hydroxy-[2-[(E)-2-methylbut-2-enoyl]anilino]methyl]pyrrolidine-1-carboxylate (PubChem CID 144620597) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is tert-butyl (2R)-2-[hydroxy-[2-[(E)-2-methylbut-2-enoyl]anilino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[hydroxy-[2-[(E)-2-methylbut-2-enoyl]anilino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 144620597 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | tert-butyl (2R)-2-[hydroxy-[2-[(E)-2-methylbut-2-enoyl]anilino]methyl]pyrrolidine-1-carboxylate |
| SMILES | C/C=C(\C)C(=O)c1ccccc1NC(O)[C@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30N2O4/c1-6-14(2)18(24)15-10-7-8-11-16(15)22-19(25)17-12-9-13-23(17)20(26)27-21(3,4)5/h6-8,10-11,17,19,22,25H,9,12-13H2,1-5H3/b14-6+/t17-,19?/m1/s1 |
| InChIKey | DPMTXMSJZSHINC-QEJMNVJJSA-N |
| XLogP | 3.97 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|