C16H29NO5Si — CID 10405189
2-[tert-butyl(dimethyl)silyl]oxy-2-[(2S)-1-prop-2-enoxycarbonylpyrrolidin-2-yl]acetic acid (PubChem CID 10405189) has the molecular formula C16H29NO5Si and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-[(2S)-1-prop-2-enoxycarbonylpyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-[(2S)-1-prop-2-enoxycarbonylpyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 10405189 |
| Molecular Formula | C16H29NO5Si |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-[(2S)-1-prop-2-enoxycarbonylpyrrolidin-2-yl]acetic acid |
| SMILES | C=CCOC(=O)N1CCC[C@H]1C(O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H29NO5Si/c1-7-11-21-15(20)17-10-8-9-12(17)13(14(18)19)22-23(5,6)16(2,3)4/h7,12-13H,1,8-11H2,2-6H3,(H,18,19)/t12-,13?/m0/s1 |
| InChIKey | UMVRCXMMFLCHPY-UEWDXFNNSA-N |
| XLogP | 3.25 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|