C17H33NO4Si — CID 67752118
prop-2-enyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-2-hydroxypropyl]pyrrolidine-1-carboxylate (PubChem CID 67752118) has the molecular formula C17H33NO4Si and a molecular weight of 343.54 g/mol. Its IUPAC name is prop-2-enyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-2-hydroxypropyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-2-hydroxypropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67752118 |
| Molecular Formula | C17H33NO4Si |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | prop-2-enyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-2-hydroxypropyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC(O[Si](C)(C)C(C)(C)C)CC1C[C@@H](C)O |
| InChI | InChI=1S/C17H33NO4Si/c1-8-9-21-16(20)18-12-15(11-14(18)10-13(2)19)22-23(6,7)17(3,4)5/h8,13-15,19H,1,9-12H2,2-7H3/t13-,14?,15?/m1/s1 |
| InChIKey | KSTVQPHCAKXYSK-WLYUNCDWSA-N |
| XLogP | 3.54 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|