C20H31N3O3SSi — CID 20639566
prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(imidazo[5,1-b][1,3]thiazol-3-ylmethyl)pyrrolidine-1-carboxylate (PubChem CID 20639566) has the molecular formula C20H31N3O3SSi and a molecular weight of 421.64 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(imidazo[5,1-b][1,3]thiazol-3-ylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(imidazo[5,1-b][1,3]thiazol-3-ylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 20639566 |
| Molecular Formula | C20H31N3O3SSi |
| Molecular Weight | 421.64 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(imidazo[5,1-b][1,3]thiazol-3-ylmethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1Cc1csc2cncn12 |
| InChI | InChI=1S/C20H31N3O3SSi/c1-7-8-25-19(24)22-12-17(26-28(5,6)20(2,3)4)10-15(22)9-16-13-27-18-11-21-14-23(16)18/h7,11,13-15,17H,1,8-10,12H2,2-6H3/t15-,17-/m1/s1 |
| InChIKey | WCFCHGQGSTVVLE-NVXWUHKLSA-N |
| XLogP | 4.73 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|