C22H33N3O4S2Si — CID 20639565
prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[ethanethioyloxy(imidazo[5,1-b][1,3]thiazol-3-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 20639565) has the molecular formula C22H33N3O4S2Si and a molecular weight of 495.74 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[ethanethioyloxy(imidazo[5,1-b][1,3]thiazol-3-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[ethanethioyloxy(imidazo[5,1-b][1,3]thiazol-3-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 20639565 |
| Molecular Formula | C22H33N3O4S2Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[ethanethioyloxy(imidazo[5,1-b][1,3]thiazol-3-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1C(OC(C)=S)c1csc2cncn12 |
| InChI | InChI=1S/C22H33N3O4S2Si/c1-8-9-27-21(26)24-12-16(29-32(6,7)22(3,4)5)10-17(24)20(28-15(2)30)18-13-31-19-11-23-14-25(18)19/h8,11,13-14,16-17,20H,1,9-10,12H2,2-7H3/t16-,17-,20?/m1/s1 |
| InChIKey | NIQIQKABQOUKND-LGJCEAAXSA-N |
| XLogP | 5.59 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|