C23H39N3O6Si — CID 54155177
prop-2-enyl 4-[[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enoxycarbonylpyrrolidin-2-yl]methyl]-3-oxopiperazine-1-carboxylate (PubChem CID 54155177) has the molecular formula C23H39N3O6Si and a molecular weight of 481.67 g/mol. Its IUPAC name is prop-2-enyl 4-[[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enoxycarbonylpyrrolidin-2-yl]methyl]-3-oxopiperazine-1-carboxylate.
| Compound Name | prop-2-enyl 4-[[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enoxycarbonylpyrrolidin-2-yl]methyl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 54155177 |
| Molecular Formula | C23H39N3O6Si |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | prop-2-enyl 4-[[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enoxycarbonylpyrrolidin-2-yl]methyl]-3-oxopiperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCN(C[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CN2C(=O)OCC=C)C(=O)C1 |
| InChI | InChI=1S/C23H39N3O6Si/c1-8-12-30-21(28)25-11-10-24(20(27)17-25)15-18-14-19(32-33(6,7)23(3,4)5)16-26(18)22(29)31-13-9-2/h8-9,18-19H,1-2,10-17H2,3-7H3/t18-,19+/m0/s1 |
| InChIKey | OKNUNJMYLIXIRS-RBUKOAKNSA-N |
| XLogP | 3.24 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|