C20H35N3O5Si — CID 57297064
prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-formyl-2-oxopiperazin-1-yl)-2-methylpyrrolidine-1-carboxylate (PubChem CID 57297064) has the molecular formula C20H35N3O5Si and a molecular weight of 425.60 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-formyl-2-oxopiperazin-1-yl)-2-methylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-formyl-2-oxopiperazin-1-yl)-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57297064 |
| Molecular Formula | C20H35N3O5Si |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-formyl-2-oxopiperazin-1-yl)-2-methylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(C)N1CCN(C=O)CC1=O |
| InChI | InChI=1S/C20H35N3O5Si/c1-8-11-27-18(26)23-13-16(28-29(6,7)19(2,3)4)12-20(23,5)22-10-9-21(15-24)14-17(22)25/h8,15-16H,1,9-14H2,2-7H3/t16-,20+/m1/s1 |
| InChIKey | JGTNBDUWZFENQD-UZLBHIALSA-N |
| XLogP | 2.42 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|