C20H30N2O6Si — CID 154478975
(4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-2-methylpyrrolidine-1-carboxylate (PubChem CID 154478975) has the molecular formula C20H30N2O6Si and a molecular weight of 422.55 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-2-methylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154478975 |
| Molecular Formula | C20H30N2O6Si |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-2-methylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CN(C(=O)OCc2ccc([N+](=O)[O-])cc2)[C@](C)(C=O)C1 |
| InChI | InChI=1S/C20H30N2O6Si/c1-19(2,3)29(5,6)28-17-11-20(4,14-23)21(12-17)18(24)27-13-15-7-9-16(10-8-15)22(25)26/h7-10,14,17H,11-13H2,1-6H3/t17-,20+/m1/s1 |
| InChIKey | MZWSUKABYNIQEC-XLIONFOSSA-N |
| XLogP | 4.29 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|