C28H45N3O8Si — CID 57323164
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[4-(hydroxymethyl)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate (PubChem CID 57323164) has the molecular formula C28H45N3O8Si and a molecular weight of 579.77 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[4-(hydroxymethyl)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[4-(hydroxymethyl)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57323164 |
| Molecular Formula | C28H45N3O8Si |
| Molecular Weight | 579.77 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[4-(hydroxymethyl)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C1CN(C(=O)OCc2ccc([N+](=O)[O-])cc2)CC1CO |
| InChI | InChI=1S/C28H45N3O8Si/c1-27(2,3)38-26(34)30-15-22(39-40(7,8)28(4,5)6)13-24(30)23-16-29(14-20(23)17-32)25(33)37-18-19-9-11-21(12-10-19)31(35)36/h9-12,20,22-24,32H,13-18H2,1-8H3/t20?,22-,23?,24+/m1/s1 |
| InChIKey | INERZDNIVZFTNK-BVWUFBLMSA-N |
| XLogP | 5.17 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.77 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|