C29H37N5O9Si — CID 18638798
(4-nitrophenyl)methyl 2-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]-4,5-dihydroimidazole-1-carboxylate (PubChem CID 18638798) has the molecular formula C29H37N5O9Si and a molecular weight of 627.73 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]-4,5-dihydroimidazole-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]-4,5-dihydroimidazole-1-carboxylate |
|---|---|
| PubChem CID | 18638798 |
| Molecular Formula | C29H37N5O9Si |
| Molecular Weight | 627.73 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]-4,5-dihydroimidazole-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](C2=NCCN2C(=O)OCc2ccc([N+](=O)[O-])cc2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C29H37N5O9Si/c1-29(2,3)44(4,5)43-24-16-25(32(17-24)28(36)42-19-21-8-12-23(13-9-21)34(39)40)26-30-14-15-31(26)27(35)41-18-20-6-10-22(11-7-20)33(37)38/h6-13,24-25H,14-19H2,1-5H3/t24-,25+/m1/s1 |
| InChIKey | LXXHAKARZUHDED-RPBOFIJWSA-N |
| XLogP | 5.66 |
| TPSA | 166.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|