C21H34N2O6SSi — CID 22874036
(4-nitrophenyl)methyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethylsulfanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 22874036) has the molecular formula C21H34N2O6SSi and a molecular weight of 470.66 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethylsulfanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethylsulfanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 22874036 |
| Molecular Formula | C21H34N2O6SSi |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethylsulfanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](CSCCO)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C21H34N2O6SSi/c1-21(2,3)31(4,5)29-19-12-18(15-30-11-10-24)22(13-19)20(25)28-14-16-6-8-17(9-7-16)23(26)27/h6-9,18-19,24H,10-15H2,1-5H3/t18-,19-/m0/s1 |
| InChIKey | SVKWRLZWOCTJFI-OALUTQOASA-N |
| XLogP | 4.42 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|