C22H38N4O5Si — CID 18641471
(4-nitrophenyl)methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 18641471) has the molecular formula C22H38N4O5Si and a molecular weight of 466.66 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18641471 |
| Molecular Formula | C22H38N4O5Si |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2,2-dimethylhydrazinyl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CN(C)NCC[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H38N4O5Si/c1-22(2,3)32(6,7)31-20-14-19(12-13-23-24(4)5)25(15-20)21(27)30-16-17-8-10-18(11-9-17)26(28)29/h8-11,19-20,23H,12-16H2,1-7H3/t19-,20-/m1/s1 |
| InChIKey | ZWCZPRXJSIJYHY-WOJBJXKFSA-N |
| XLogP | 4.15 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|