C22H34N2O3Si — CID 15671515
benzyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-cyanopropyl)pyrrolidine-1-carboxylate (PubChem CID 15671515) has the molecular formula C22H34N2O3Si and a molecular weight of 402.61 g/mol. Its IUPAC name is benzyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-cyanopropyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-cyanopropyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15671515 |
| Molecular Formula | C22H34N2O3Si |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | benzyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-cyanopropyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](CCCC#N)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C22H34N2O3Si/c1-22(2,3)28(4,5)27-20-15-19(13-9-10-14-23)24(16-20)21(25)26-17-18-11-7-6-8-12-18/h6-8,11-12,19-20H,9-10,13,15-17H2,1-5H3/t19-,20-/m1/s1 |
| InChIKey | FUXDZKHADHMFMZ-WOJBJXKFSA-N |
| XLogP | 5.48 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|