C22H35NO5Si — CID 169225497
1-O-benzyl 2-O-methyl (2S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethylpyrrolidine-1,2-dicarboxylate (PubChem CID 169225497) has the molecular formula C22H35NO5Si and a molecular weight of 421.61 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 169225497 |
| Molecular Formula | C22H35NO5Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethylpyrrolidine-1,2-dicarboxylate |
| SMILES | CC[C@@H]1[C@@H](C(=O)OC)N(C(=O)OCc2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H35NO5Si/c1-8-17-18(28-29(6,7)22(2,3)4)14-23(19(17)20(24)26-5)21(25)27-15-16-12-10-9-11-13-16/h9-13,17-19H,8,14-15H2,1-7H3/t17-,18+,19-/m0/s1 |
| InChIKey | SIDBUNLMNIMAAR-OTWHNJEPSA-N |
| XLogP | 4.60 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|