C24H37NO7Si — CID 15671502
dimethyl 2-[[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonylpyrrolidin-2-yl]methyl]propanedioate (PubChem CID 15671502) has the molecular formula C24H37NO7Si and a molecular weight of 479.65 g/mol. Its IUPAC name is dimethyl 2-[[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonylpyrrolidin-2-yl]methyl]propanedioate.
| Compound Name | dimethyl 2-[[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonylpyrrolidin-2-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 15671502 |
| Molecular Formula | C24H37NO7Si |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | dimethyl 2-[[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonylpyrrolidin-2-yl]methyl]propanedioate |
| SMILES | COC(=O)C(C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C24H37NO7Si/c1-24(2,3)33(6,7)32-19-13-18(14-20(21(26)29-4)22(27)30-5)25(15-19)23(28)31-16-17-11-9-8-10-12-17/h8-12,18-20H,13-16H2,1-7H3/t18-,19+/m0/s1 |
| InChIKey | XZNICZZJOUNOBB-RBUKOAKNSA-N |
| XLogP | 4.14 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|