C26H40N2O7Si — CID 135014336
methyl 2-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]pyrrolidin-2-yl]-2-oxoacetate (PubChem CID 135014336) has the molecular formula C26H40N2O7Si and a molecular weight of 520.70 g/mol. Its IUPAC name is methyl 2-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]pyrrolidin-2-yl]-2-oxoacetate.
| Compound Name | methyl 2-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]pyrrolidin-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 135014336 |
| Molecular Formula | C26H40N2O7Si |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | methyl 2-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]pyrrolidin-2-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C26H40N2O7Si/c1-17(2)21(27-25(32)34-16-18-12-10-9-11-13-18)23(30)28-15-19(35-36(7,8)26(3,4)5)14-20(28)22(29)24(31)33-6/h9-13,17,19-21H,14-16H2,1-8H3,(H,27,32)/t19-,20+,21+/m1/s1 |
| InChIKey | RRUVWFWNSUSMGC-HKBOAZHASA-N |
| XLogP | 3.67 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|