C18H29NO3Si — CID 67033582
1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-2-carboxylic acid (PubChem CID 67033582) has the molecular formula C18H29NO3Si and a molecular weight of 335.52 g/mol. Its IUPAC name is 1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67033582 |
| Molecular Formula | C18H29NO3Si |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(C(=O)O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H29NO3Si/c1-18(2,3)23(4,5)22-15-11-16(17(20)21)19(13-15)12-14-9-7-6-8-10-14/h6-10,15-16H,11-13H2,1-5H3,(H,20,21) |
| InChIKey | STTQFRBUZRJOPW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|