C22H34BrN3OSi — CID 139716813
[(3R,5R)-1-benzyl-5-[(4-bromo-1-methylpyrazol-5-yl)methyl]pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 139716813) has the molecular formula C22H34BrN3OSi and a molecular weight of 464.52 g/mol. Its IUPAC name is [(3R,5R)-1-benzyl-5-[(4-bromo-1-methylpyrazol-5-yl)methyl]pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,5R)-1-benzyl-5-[(4-bromo-1-methylpyrazol-5-yl)methyl]pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 139716813 |
| Molecular Formula | C22H34BrN3OSi |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [(3R,5R)-1-benzyl-5-[(4-bromo-1-methylpyrazol-5-yl)methyl]pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | Cn1ncc(Br)c1C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H34BrN3OSi/c1-22(2,3)28(5,6)27-19-12-18(13-21-20(23)14-24-25(21)4)26(16-19)15-17-10-8-7-9-11-17/h7-11,14,18-19H,12-13,15-16H2,1-6H3/t18-,19+/m0/s1 |
| InChIKey | BYYTVRHMFCUTSS-RBUKOAKNSA-N |
| XLogP | 5.39 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|