C18H29NO2Si — CID 102262809
(5S)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one (PubChem CID 102262809) has the molecular formula C18H29NO2Si and a molecular weight of 319.52 g/mol. Its IUPAC name is (5S)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one.
| Compound Name | (5S)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one |
|---|---|
| PubChem CID | 102262809 |
| Molecular Formula | C18H29NO2Si |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | (5S)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H29NO2Si/c1-18(2,3)22(4,5)21-16-11-12-17(20)19(14-16)13-15-9-7-6-8-10-15/h6-10,16H,11-14H2,1-5H3/t16-/m0/s1 |
| InChIKey | ZIQQFUCTDZFPGT-INIZCTEOSA-N |
| XLogP | 4.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|