C18H31NOSi — CID 139674628
[(3R,5R)-1-benzyl-5-methylpyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 139674628) has the molecular formula C18H31NOSi and a molecular weight of 305.54 g/mol. Its IUPAC name is [(3R,5R)-1-benzyl-5-methylpyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,5R)-1-benzyl-5-methylpyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 139674628 |
| Molecular Formula | C18H31NOSi |
| Molecular Weight | 305.54 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | [(3R,5R)-1-benzyl-5-methylpyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C18H31NOSi/c1-15-12-17(20-21(5,6)18(2,3)4)14-19(15)13-16-10-8-7-9-11-16/h7-11,15,17H,12-14H2,1-6H3/t15-,17-/m1/s1 |
| InChIKey | YRQPVTLZMPSZCE-NVXWUHKLSA-N |
| XLogP | 4.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|