C13H19N — CID 118651465
(4S)-1-benzyl-2,4-dimethylpyrrolidine (PubChem CID 118651465) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (4S)-1-benzyl-2,4-dimethylpyrrolidine.
| Compound Name | (4S)-1-benzyl-2,4-dimethylpyrrolidine |
|---|---|
| PubChem CID | 118651465 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (4S)-1-benzyl-2,4-dimethylpyrrolidine |
| SMILES | CC1C[C@H](C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C13H19N/c1-11-8-12(2)14(9-11)10-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3/t11-,12?/m0/s1 |
| InChIKey | VYYZTSMKEIEVPP-PXYINDEMSA-N |
| XLogP | 2.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |