C14H22N2 — CID 72621990
1-benzyl-2,4,5-trimethylpiperazine (PubChem CID 72621990) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-benzyl-2,4,5-trimethylpiperazine.
| Compound Name | 1-benzyl-2,4,5-trimethylpiperazine |
|---|---|
| PubChem CID | 72621990 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-benzyl-2,4,5-trimethylpiperazine |
| SMILES | CC1CN(Cc2ccccc2)C(C)CN1C |
| InChI | InChI=1S/C14H22N2/c1-12-10-16(13(2)9-15(12)3)11-14-7-5-4-6-8-14/h4-8,12-13H,9-11H2,1-3H3 |
| InChIKey | VGXYQRIQYDOJFR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |