C17H32N2 — CID 145145723
1-benzyl-2,4-dimethylpiperazine;ethane (PubChem CID 145145723) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-benzyl-2,4-dimethylpiperazine;ethane.
| Compound Name | 1-benzyl-2,4-dimethylpiperazine;ethane |
|---|---|
| PubChem CID | 145145723 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1-benzyl-2,4-dimethylpiperazine;ethane |
| SMILES | CC.CC.CC1CN(C)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C13H20N2.2C2H6/c1-12-10-14(2)8-9-15(12)11-13-6-4-3-5-7-13;2*1-2/h3-7,12H,8-11H2,1-2H3;2*1-2H3 |
| InChIKey | MFKVMLYNANLSAE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |