C14H19N3 — CID 71877621
3-[(2,4-dimethylpiperazin-1-yl)methyl]benzonitrile (PubChem CID 71877621) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 3-[(2,4-dimethylpiperazin-1-yl)methyl]benzonitrile.
| Compound Name | 3-[(2,4-dimethylpiperazin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 71877621 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 3-[(2,4-dimethylpiperazin-1-yl)methyl]benzonitrile |
| SMILES | CC1CN(C)CCN1Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C14H19N3/c1-12-10-16(2)6-7-17(12)11-14-5-3-4-13(8-14)9-15/h3-5,8,12H,6-7,10-11H2,1-2H3 |
| InChIKey | UIHHHLXPRKELDG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |