C19H27N3 — CID 134204297
3-[(4-cyclobutyl-2-propan-2-ylpiperazin-1-yl)methyl]benzonitrile (PubChem CID 134204297) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 3-[(4-cyclobutyl-2-propan-2-ylpiperazin-1-yl)methyl]benzonitrile.
| Compound Name | 3-[(4-cyclobutyl-2-propan-2-ylpiperazin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 134204297 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 3-[(4-cyclobutyl-2-propan-2-ylpiperazin-1-yl)methyl]benzonitrile |
| SMILES | CC(C)C1CN(C2CCC2)CCN1Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C19H27N3/c1-15(2)19-14-21(18-7-4-8-18)9-10-22(19)13-17-6-3-5-16(11-17)12-20/h3,5-6,11,15,18-19H,4,7-10,13-14H2,1-2H3 |
| InChIKey | UFUQSTKXOMJGII-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |