C18H26N4 — CID 24736594
3-[[4-(1,4-diazepan-1-yl)piperidin-1-yl]methyl]benzonitrile (PubChem CID 24736594) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-[[4-(1,4-diazepan-1-yl)piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-(1,4-diazepan-1-yl)piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 24736594 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 3-[[4-(1,4-diazepan-1-yl)piperidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CCC(N3CCCNCC3)CC2)c1 |
| InChI | InChI=1S/C18H26N4/c19-14-16-3-1-4-17(13-16)15-21-10-5-18(6-11-21)22-9-2-7-20-8-12-22/h1,3-4,13,18,20H,2,5-12,15H2 |
| InChIKey | OFFCZMTWVZYGFL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |