C22H30N4O2 — CID 97344069
3-[[4-[(3R)-1-(oxan-4-yl)-2-oxopiperidin-3-yl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 97344069) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 3-[[4-[(3R)-1-(oxan-4-yl)-2-oxopiperidin-3-yl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-[(3R)-1-(oxan-4-yl)-2-oxopiperidin-3-yl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 97344069 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 3-[[4-[(3R)-1-(oxan-4-yl)-2-oxopiperidin-3-yl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CCN([C@@H]3CCCN(C4CCOCC4)C3=O)CC2)c1 |
| InChI | InChI=1S/C22H30N4O2/c23-16-18-3-1-4-19(15-18)17-24-9-11-25(12-10-24)21-5-2-8-26(22(21)27)20-6-13-28-14-7-20/h1,3-4,15,20-21H,2,5-14,17H2/t21-/m1/s1 |
| InChIKey | QFRMORKHBOKCMA-OAQYLSRUSA-N |
| XLogP | 1.85 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |