C15H22N2 — CID 130838279
4-benzyl-2-methyl-1,4-diazabicyclo[3.2.2]nonane (PubChem CID 130838279) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 4-benzyl-2-methyl-1,4-diazabicyclo[3.2.2]nonane.
| Compound Name | 4-benzyl-2-methyl-1,4-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 130838279 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 4-benzyl-2-methyl-1,4-diazabicyclo[3.2.2]nonane |
| SMILES | CC1CN(Cc2ccccc2)C2CCN1CC2 |
| InChI | InChI=1S/C15H22N2/c1-13-11-17(12-14-5-3-2-4-6-14)15-7-9-16(13)10-8-15/h2-6,13,15H,7-12H2,1H3 |
| InChIKey | DGXHOFZGUFJSQT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |