C12H16ClN — CID 101162371
(2S,4S)-1-benzyl-4-chloro-2-methylpyrrolidine (PubChem CID 101162371) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is (2S,4S)-1-benzyl-4-chloro-2-methylpyrrolidine.
| Compound Name | (2S,4S)-1-benzyl-4-chloro-2-methylpyrrolidine |
|---|---|
| PubChem CID | 101162371 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (2S,4S)-1-benzyl-4-chloro-2-methylpyrrolidine |
| SMILES | C[C@H]1C[C@H](Cl)CN1Cc1ccccc1 |
| InChI | InChI=1S/C12H16ClN/c1-10-7-12(13)9-14(10)8-11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3/t10-,12-/m0/s1 |
| InChIKey | HYLFOURAFDRXOE-JQWIXIFHSA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|