C27H38N4O — CID 166232254
1,3-bis[(1-benzyl-5-methylpyrrolidin-3-yl)methyl]urea (PubChem CID 166232254) has the molecular formula C27H38N4O and a molecular weight of 434.63 g/mol. Its IUPAC name is 1,3-bis[(1-benzyl-5-methylpyrrolidin-3-yl)methyl]urea.
| Compound Name | 1,3-bis[(1-benzyl-5-methylpyrrolidin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 166232254 |
| Molecular Formula | C27H38N4O |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 1,3-bis[(1-benzyl-5-methylpyrrolidin-3-yl)methyl]urea |
| SMILES | CC1CC(CNC(=O)NCC2CC(C)N(Cc3ccccc3)C2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C27H38N4O/c1-21-13-25(19-30(21)17-23-9-5-3-6-10-23)15-28-27(32)29-16-26-14-22(2)31(20-26)18-24-11-7-4-8-12-24/h3-12,21-22,25-26H,13-20H2,1-2H3,(H2,28,29,32) |
| InChIKey | RUZKIBGEBMRHAN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |