C13H21N3O2S — CID 124569518
(2R,4S)-1-benzyl-2-methyl-4-[(sulfamoylamino)methyl]pyrrolidine (PubChem CID 124569518) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is (2R,4S)-1-benzyl-2-methyl-4-[(sulfamoylamino)methyl]pyrrolidine.
| Compound Name | (2R,4S)-1-benzyl-2-methyl-4-[(sulfamoylamino)methyl]pyrrolidine |
|---|---|
| PubChem CID | 124569518 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (2R,4S)-1-benzyl-2-methyl-4-[(sulfamoylamino)methyl]pyrrolidine |
| SMILES | C[C@@H]1C[C@H](CNS(N)(=O)=O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C13H21N3O2S/c1-11-7-13(8-15-19(14,17)18)10-16(11)9-12-5-3-2-4-6-12/h2-6,11,13,15H,7-10H2,1H3,(H2,14,17,18)/t11-,13-/m1/s1 |
| InChIKey | PMPPOLPUODHVJS-DGCLKSJQSA-N |
| XLogP | 0.69 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |