C28H44N4 — CID 101436229
4,11-dibenzyl-1,5,8,12-tetramethyl-1,4,8,11-tetrazacyclotetradecane (PubChem CID 101436229) has the molecular formula C28H44N4 and a molecular weight of 436.69 g/mol. Its IUPAC name is 4,11-dibenzyl-1,5,8,12-tetramethyl-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 4,11-dibenzyl-1,5,8,12-tetramethyl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 101436229 |
| Molecular Formula | C28H44N4 |
| Molecular Weight | 436.69 g/mol |
| Exact Mass | 436.36 |
| IUPAC Name | 4,11-dibenzyl-1,5,8,12-tetramethyl-1,4,8,11-tetrazacyclotetradecane |
| SMILES | CC1CCN(C)CCN(Cc2ccccc2)C(C)CCN(C)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C28H44N4/c1-25-15-17-29(3)20-22-32(24-28-13-9-6-10-14-28)26(2)16-18-30(4)19-21-31(25)23-27-11-7-5-8-12-27/h5-14,25-26H,15-24H2,1-4H3 |
| InChIKey | SKJUUKWSLCCLDO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |