C18H29N3O — CID 97092572
N-[3-[(5R)-4-benzyl-5-methyl-1,4-diazepan-1-yl]propyl]acetamide (PubChem CID 97092572) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is N-[3-[(5R)-4-benzyl-5-methyl-1,4-diazepan-1-yl]propyl]acetamide.
| Compound Name | N-[3-[(5R)-4-benzyl-5-methyl-1,4-diazepan-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 97092572 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | N-[3-[(5R)-4-benzyl-5-methyl-1,4-diazepan-1-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCN1CC[C@@H](C)N(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H29N3O/c1-16-9-12-20(11-6-10-19-17(2)22)13-14-21(16)15-18-7-4-3-5-8-18/h3-5,7-8,16H,6,9-15H2,1-2H3,(H,19,22)/t16-/m1/s1 |
| InChIKey | YAOFVBFGWVZMGH-MRXNPFEDSA-N |
| XLogP | 2.11 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|